C18H24N6 — CID 166954392
6-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-N-(1-pyrrolidin-3-ylethenyl)isoquinolin-3-amine (PubChem CID 166954392) has the molecular formula C18H24N6 and a molecular weight of 324.43 g/mol. Its IUPAC name is 6-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-N-(1-pyrrolidin-3-ylethenyl)isoquinolin-3-amine.
| Compound Name | 6-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-N-(1-pyrrolidin-3-ylethenyl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 166954392 |
| Molecular Formula | C18H24N6 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 6-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-N-(1-pyrrolidin-3-ylethenyl)isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2cc(/C(=C/N)N(C)N)ccc2cn1)C1CCNC1 |
| InChI | InChI=1S/C18H24N6/c1-12(14-5-6-21-10-14)23-18-8-16-7-13(17(9-19)24(2)20)3-4-15(16)11-22-18/h3-4,7-9,11,14,21H,1,5-6,10,19-20H2,2H3,(H,22,23)/b17-9- |
| InChIKey | KQOUEJDATFLHEB-MFOYZWKCSA-N |
| XLogP | 1.83 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|