C22H25FN6 — CID 142575437
N-[1-[4-(2-fluoroethylamino)piperidin-1-yl]ethenyl]-6-pyrazin-2-ylisoquinolin-3-amine (PubChem CID 142575437) has the molecular formula C22H25FN6 and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[1-[4-(2-fluoroethylamino)piperidin-1-yl]ethenyl]-6-pyrazin-2-ylisoquinolin-3-amine.
| Compound Name | N-[1-[4-(2-fluoroethylamino)piperidin-1-yl]ethenyl]-6-pyrazin-2-ylisoquinolin-3-amine |
|---|---|
| PubChem CID | 142575437 |
| Molecular Formula | C22H25FN6 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[1-[4-(2-fluoroethylamino)piperidin-1-yl]ethenyl]-6-pyrazin-2-ylisoquinolin-3-amine |
| SMILES | C=C(Nc1cc2cc(-c3cnccn3)ccc2cn1)N1CCC(NCCF)CC1 |
| InChI | InChI=1S/C22H25FN6/c1-16(29-10-4-20(5-11-29)25-7-6-23)28-22-13-19-12-17(2-3-18(19)14-27-22)21-15-24-8-9-26-21/h2-3,8-9,12-15,20,25H,1,4-7,10-11H2,(H,27,28) |
| InChIKey | TUMMTDIRTDNSSK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |