C28H27N3O2 — CID 118063587
N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]quinoline-6-carboxamide (PubChem CID 118063587) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]quinoline-6-carboxamide.
| Compound Name | N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 118063587 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]quinoline-6-carboxamide |
| SMILES | CN1CCC(Oc2ccc(-c3ccc(NC(=O)c4ccc5ncccc5c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H27N3O2/c1-31-17-14-26(15-18-31)33-25-11-6-21(7-12-25)20-4-9-24(10-5-20)30-28(32)23-8-13-27-22(19-23)3-2-16-29-27/h2-13,16,19,26H,14-15,17-18H2,1H3,(H,30,32) |
| InChIKey | DUVAGPPJCTVCLZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |