C19H20Cl2N2O2 — CID 171152518
3,5-dichloro-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]benzamide (PubChem CID 171152518) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]benzamide |
|---|---|
| PubChem CID | 171152518 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3,5-dichloro-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]benzamide |
| SMILES | CN1CCC(Oc2ccc(NC(=O)c3cc(Cl)cc(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-23-8-6-18(7-9-23)25-17-4-2-16(3-5-17)22-19(24)13-10-14(20)12-15(21)11-13/h2-5,10-12,18H,6-9H2,1H3,(H,22,24) |
| InChIKey | VRVIFQZZJAPXOO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |