C19H23F2N3O2 — CID 131951976
1-(difluoromethyl)-5-methyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrrole-2-carboxamide (PubChem CID 131951976) has the molecular formula C19H23F2N3O2 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-(difluoromethyl)-5-methyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrrole-2-carboxamide.
| Compound Name | 1-(difluoromethyl)-5-methyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 131951976 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-(difluoromethyl)-5-methyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]pyrrole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(OC3CCN(C)CC3)cc2)n1C(F)F |
| InChI | InChI=1S/C19H23F2N3O2/c1-13-3-8-17(24(13)19(20)21)18(25)22-14-4-6-15(7-5-14)26-16-9-11-23(2)12-10-16/h3-8,16,19H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | YFYUZTCDJIHFOF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |