C18H22F2N4O4 — CID 154912795
5-(difluoromethyl)-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrazole-3-carboxamide;formic acid (PubChem CID 154912795) has the molecular formula C18H22F2N4O4 and a molecular weight of 396.39 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrazole-3-carboxamide;formic acid.
| Compound Name | 5-(difluoromethyl)-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 154912795 |
| Molecular Formula | C18H22F2N4O4 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 5-(difluoromethyl)-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrazole-3-carboxamide;formic acid |
| SMILES | CN1CCC(Oc2ccc(NC(=O)c3cc(C(F)F)[nH]n3)cc2)CC1.O=CO |
| InChI | InChI=1S/C17H20F2N4O2.CH2O2/c1-23-8-6-13(7-9-23)25-12-4-2-11(3-5-12)20-17(24)15-10-14(16(18)19)21-22-15;2-1-3/h2-5,10,13,16H,6-9H2,1H3,(H,20,24)(H,21,22);1H,(H,2,3) |
| InChIKey | BCZBHSMPHXFGSW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|