C33H32N2O5 — CID 118063387
[3-[2-hydroxy-5-[[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]carbamoyl]phenyl]phenyl] acetate (PubChem CID 118063387) has the molecular formula C33H32N2O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is [3-[2-hydroxy-5-[[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]carbamoyl]phenyl]phenyl] acetate.
| Compound Name | [3-[2-hydroxy-5-[[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]carbamoyl]phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 118063387 |
| Molecular Formula | C33H32N2O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | [3-[2-hydroxy-5-[[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]carbamoyl]phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(-c2cc(C(=O)Nc3ccc(-c4ccc(OC5CCN(C)CC5)cc4)cc3)ccc2O)c1 |
| InChI | InChI=1S/C33H32N2O5/c1-22(36)39-30-5-3-4-25(20-30)31-21-26(10-15-32(31)37)33(38)34-27-11-6-23(7-12-27)24-8-13-28(14-9-24)40-29-16-18-35(2)19-17-29/h3-15,20-21,29,37H,16-19H2,1-2H3,(H,34,38) |
| InChIKey | ARAYNUPQEVHLMY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|