C33H32N2O5 — CID 167018948
N-[4-[4-(1-formylpiperidin-4-yl)oxyphenyl]phenyl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 167018948) has the molecular formula C33H32N2O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is N-[4-[4-(1-formylpiperidin-4-yl)oxyphenyl]phenyl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[4-[4-(1-formylpiperidin-4-yl)oxyphenyl]phenyl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 167018948 |
| Molecular Formula | C33H32N2O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | N-[4-[4-(1-formylpiperidin-4-yl)oxyphenyl]phenyl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3ccc(-c4ccc(OC5CCN(C=O)CC5)cc4)cc3)ccc2OC)c1 |
| InChI | InChI=1S/C33H32N2O5/c1-38-30-5-3-4-25(20-30)31-21-26(10-15-32(31)39-2)33(37)34-27-11-6-23(7-12-27)24-8-13-28(14-9-24)40-29-16-18-35(22-36)19-17-29/h3-15,20-22,29H,16-19H2,1-2H3,(H,34,37) |
| InChIKey | BLZCRZQKIQYLCX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|