C27H27N3O4 — CID 24733705
N-(2-cyanophenyl)-4-[3-(2,5-dimethoxyphenyl)phenoxy]piperidine-1-carboxamide (PubChem CID 24733705) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-(2-cyanophenyl)-4-[3-(2,5-dimethoxyphenyl)phenoxy]piperidine-1-carboxamide.
| Compound Name | N-(2-cyanophenyl)-4-[3-(2,5-dimethoxyphenyl)phenoxy]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 24733705 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-(2-cyanophenyl)-4-[3-(2,5-dimethoxyphenyl)phenoxy]piperidine-1-carboxamide |
| SMILES | COc1ccc(OC)c(-c2cccc(OC3CCN(C(=O)Nc4ccccc4C#N)CC3)c2)c1 |
| InChI | InChI=1S/C27H27N3O4/c1-32-22-10-11-26(33-2)24(17-22)19-7-5-8-23(16-19)34-21-12-14-30(15-13-21)27(31)29-25-9-4-3-6-20(25)18-28/h3-11,16-17,21H,12-15H2,1-2H3,(H,29,31) |
| InChIKey | JZTZXVQCGGYZBK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |