C25H26N4O2S — CID 134575874
ethenyl N-methyl-3-[(4-piperidin-4-yloxybenzoyl)amino]isoquinoline-6-carboximidothioate (PubChem CID 134575874) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is ethenyl N-methyl-3-[(4-piperidin-4-yloxybenzoyl)amino]isoquinoline-6-carboximidothioate.
| Compound Name | ethenyl N-methyl-3-[(4-piperidin-4-yloxybenzoyl)amino]isoquinoline-6-carboximidothioate |
|---|---|
| PubChem CID | 134575874 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | ethenyl N-methyl-3-[(4-piperidin-4-yloxybenzoyl)amino]isoquinoline-6-carboximidothioate |
| SMILES | C=CS/C(=N\C)c1ccc2cnc(NC(=O)c3ccc(OC4CCNCC4)cc3)cc2c1 |
| InChI | InChI=1S/C25H26N4O2S/c1-3-32-25(26-2)18-4-5-19-16-28-23(15-20(19)14-18)29-24(30)17-6-8-21(9-7-17)31-22-10-12-27-13-11-22/h3-9,14-16,22,27H,1,10-13H2,2H3,(H,28,29,30)/b26-25- |
| InChIKey | NNEGERCUAAJVMW-QPLCGJKRSA-N |
| XLogP | 4.87 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|