C27H29N5O2 — CID 158199774
N-[6-[5-(aminomethyl)-1-methylpyrazol-4-yl]isoquinolin-3-yl]-4-cyclohexyloxybenzamide (PubChem CID 158199774) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[6-[5-(aminomethyl)-1-methylpyrazol-4-yl]isoquinolin-3-yl]-4-cyclohexyloxybenzamide.
| Compound Name | N-[6-[5-(aminomethyl)-1-methylpyrazol-4-yl]isoquinolin-3-yl]-4-cyclohexyloxybenzamide |
|---|---|
| PubChem CID | 158199774 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-[6-[5-(aminomethyl)-1-methylpyrazol-4-yl]isoquinolin-3-yl]-4-cyclohexyloxybenzamide |
| SMILES | Cn1ncc(-c2ccc3cnc(NC(=O)c4ccc(OC5CCCCC5)cc4)cc3c2)c1CN |
| InChI | InChI=1S/C27H29N5O2/c1-32-25(15-28)24(17-30-32)19-7-8-20-16-29-26(14-21(20)13-19)31-27(33)18-9-11-23(12-10-18)34-22-5-3-2-4-6-22/h7-14,16-17,22H,2-6,15,28H2,1H3,(H,29,31,33) |
| InChIKey | ZCPYFWFDZMNEDA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |