C26H26N4O2 — CID 158644367
1-(4-cyclohexyloxyphenyl)-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone (PubChem CID 158644367) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-(4-cyclohexyloxyphenyl)-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone.
| Compound Name | 1-(4-cyclohexyloxyphenyl)-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 158644367 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-(4-cyclohexyloxyphenyl)-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone |
| SMILES | Cn1cc(-c2ccc3cnc(CC(=O)c4ccc(OC5CCCCC5)cc4)cc3c2)nn1 |
| InChI | InChI=1S/C26H26N4O2/c1-30-17-25(28-29-30)19-7-8-20-16-27-22(14-21(20)13-19)15-26(31)18-9-11-24(12-10-18)32-23-5-3-2-4-6-23/h7-14,16-17,23H,2-6,15H2,1H3 |
| InChIKey | KHHXLTLFYLEDQR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |