C22H19FN4O2 — CID 158644364
1-[4-(1-fluoroethoxy)phenyl]-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone (PubChem CID 158644364) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-[4-(1-fluoroethoxy)phenyl]-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone.
| Compound Name | 1-[4-(1-fluoroethoxy)phenyl]-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 158644364 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-[4-(1-fluoroethoxy)phenyl]-2-[6-(1-methyltriazol-4-yl)isoquinolin-3-yl]ethanone |
| SMILES | CC(F)Oc1ccc(C(=O)Cc2cc3cc(-c4cn(C)nn4)ccc3cn2)cc1 |
| InChI | InChI=1S/C22H19FN4O2/c1-14(23)29-20-7-5-15(6-8-20)22(28)11-19-10-18-9-16(3-4-17(18)12-24-19)21-13-27(2)26-25-21/h3-10,12-14H,11H2,1-2H3 |
| InChIKey | CANXMVPDBWXLJP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |