C27H29N5O — CID 157330399
4-methyl-N-[6-[1-methyl-5-(piperidin-1-ylmethyl)pyrazol-4-yl]isoquinolin-3-yl]benzamide (PubChem CID 157330399) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-methyl-N-[6-[1-methyl-5-(piperidin-1-ylmethyl)pyrazol-4-yl]isoquinolin-3-yl]benzamide.
| Compound Name | 4-methyl-N-[6-[1-methyl-5-(piperidin-1-ylmethyl)pyrazol-4-yl]isoquinolin-3-yl]benzamide |
|---|---|
| PubChem CID | 157330399 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 4-methyl-N-[6-[1-methyl-5-(piperidin-1-ylmethyl)pyrazol-4-yl]isoquinolin-3-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc3cc(-c4cnn(C)c4CN4CCCCC4)ccc3cn2)cc1 |
| InChI | InChI=1S/C27H29N5O/c1-19-6-8-20(9-7-19)27(33)30-26-15-23-14-21(10-11-22(23)16-28-26)24-17-29-31(2)25(24)18-32-12-4-3-5-13-32/h6-11,14-17H,3-5,12-13,18H2,1-2H3,(H,28,30,33) |
| InChIKey | RNHWYGSXJGEWRJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |