C25H31N7O — CID 142584141
(E)-N-[7-[(E)-C-ethenyl-N-[(Z)-1-[(1-methylpiperidin-4-yl)amino]prop-1-enyl]carbonimidoyl]quinazolin-2-yl]-2-methanimidoylbut-2-enamide (PubChem CID 142584141) has the molecular formula C25H31N7O and a molecular weight of 445.57 g/mol. Its IUPAC name is (E)-N-[7-[(E)-C-ethenyl-N-[(Z)-1-[(1-methylpiperidin-4-yl)amino]prop-1-enyl]carbonimidoyl]quinazolin-2-yl]-2-methanimidoylbut-2-enamide.
| Compound Name | (E)-N-[7-[(E)-C-ethenyl-N-[(Z)-1-[(1-methylpiperidin-4-yl)amino]prop-1-enyl]carbonimidoyl]quinazolin-2-yl]-2-methanimidoylbut-2-enamide |
|---|---|
| PubChem CID | 142584141 |
| Molecular Formula | C25H31N7O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (E)-N-[7-[(E)-C-ethenyl-N-[(Z)-1-[(1-methylpiperidin-4-yl)amino]prop-1-enyl]carbonimidoyl]quinazolin-2-yl]-2-methanimidoylbut-2-enamide |
| SMILES | [H]/N=C/C(=C\C)C(=O)Nc1ncc2ccc(/C(C=C)=N/C(=C\C)NC3CCN(C)CC3)cc2n1 |
| InChI | InChI=1S/C25H31N7O/c1-5-17(15-26)24(33)31-25-27-16-19-9-8-18(14-22(19)30-25)21(6-2)29-23(7-3)28-20-10-12-32(4)13-11-20/h5-9,14-16,20,26,28H,2,10-13H2,1,3-4H3,(H,27,30,31,33)/b17-5+,23-7-,26-15+,29-21+ |
| InChIKey | YHMFHPIBEIFZRJ-DOWZRDDGSA-N |
| XLogP | 3.68 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|