C23H33N5O2 — CID 143569798
2-(cyclohexylamino)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)quinazoline-7-carboxamide (PubChem CID 143569798) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)quinazoline-7-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 143569798 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-(cyclohexylamino)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)quinazoline-7-carboxamide |
| SMILES | CC(C)(CN1CCOCC1)NC(=O)c1ccc2cnc(NC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C23H33N5O2/c1-23(2,16-28-10-12-30-13-11-28)27-21(29)17-8-9-18-15-24-22(26-20(18)14-17)25-19-6-4-3-5-7-19/h8-9,14-15,19H,3-7,10-13,16H2,1-2H3,(H,27,29)(H,24,25,26) |
| InChIKey | QELJKZRWFJAZHV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |