C15H14N2 — CID 160985483
9,10-dimethylphenanthridin-3-amine (PubChem CID 160985483) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 9,10-dimethylphenanthridin-3-amine.
| Compound Name | 9,10-dimethylphenanthridin-3-amine |
|---|---|
| PubChem CID | 160985483 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 9,10-dimethylphenanthridin-3-amine |
| SMILES | Cc1ccc2cnc3cc(N)ccc3c2c1C |
| InChI | InChI=1S/C15H14N2/c1-9-3-4-11-8-17-14-7-12(16)5-6-13(14)15(11)10(9)2/h3-8H,16H2,1-2H3 |
| InChIKey | GQOLCAOWEUEPTR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|