C10H13N3 — CID 145271203
ethane;6-methyl-1,2,4-benzotriazine (PubChem CID 145271203) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is ethane;6-methyl-1,2,4-benzotriazine.
| Compound Name | ethane;6-methyl-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 145271203 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | ethane;6-methyl-1,2,4-benzotriazine |
| SMILES | CC.Cc1ccc2nncnc2c1 |
| InChI | InChI=1S/C8H7N3.C2H6/c1-6-2-3-7-8(4-6)9-5-10-11-7;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | SPZKSFXZXCCKGX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |