C12H16N2 — CID 142320596
2,7-dimethylquinoxaline;ethane (PubChem CID 142320596) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,7-dimethylquinoxaline;ethane.
| Compound Name | 2,7-dimethylquinoxaline;ethane |
|---|---|
| PubChem CID | 142320596 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,7-dimethylquinoxaline;ethane |
| SMILES | CC.Cc1ccc2ncc(C)nc2c1 |
| InChI | InChI=1S/C10H10N2.C2H6/c1-7-3-4-9-10(5-7)12-8(2)6-11-9;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | ZVMUOKDUFWQNKJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |