C11H10N2O — CID 121218111
4,7-dimethyl-1,5-benzodiazepin-2-one (PubChem CID 121218111) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 4,7-dimethyl-1,5-benzodiazepin-2-one.
| Compound Name | 4,7-dimethyl-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 121218111 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4,7-dimethyl-1,5-benzodiazepin-2-one |
| SMILES | Cc1ccc2nc(=O)cc(C)nc2c1 |
| InChI | InChI=1S/C11H10N2O/c1-7-3-4-9-10(5-7)12-8(2)6-11(14)13-9/h3-6H,1-2H3 |
| InChIKey | YZWOILBIVDNNCD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |