About 4-(chloromethyl)-2,7-dimethylquinoline
4-(chloromethyl)-2,7-dimethylquinoline (PubChem CID 23001553) has the molecular formula C12H12ClN
and a molecular weight of 205.69 g/mol. Its IUPAC name is 4-(chloromethyl)-2,7-dimethylquinoline.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,7-dimethylquinoline |
| PubChem CID | 23001553 |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-(chloromethyl)-2,7-dimethylquinoline |
| SMILES | Cc1ccc2c(CCl)cc(C)nc2c1 |
| InChI | InChI=1S/C12H12ClN/c1-8-3-4-11-10(7-13)6-9(2)14-12(11)5-8/h3-6H,7H2,1-2H3 |
| InChIKey | GIZSOISADUFHRK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,7-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,7-dimethylquinoline?
The IUPAC name of 4-(chloromethyl)-2,7-dimethylquinoline (CID 23001553) is 4-(chloromethyl)-2,7-dimethylquinoline.
What is the SMILES notation for 4-(chloromethyl)-2,7-dimethylquinoline?
The canonical SMILES for 4-(chloromethyl)-2,7-dimethylquinoline is Cc1ccc2c(CCl)cc(C)nc2c1.
What is the InChIKey of 4-(chloromethyl)-2,7-dimethylquinoline?
The InChIKey is GIZSOISADUFHRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN/c1-8-3-4-11-10(7-13)6-9(2)14-12(11)5-8/h3-6H,7H2,1-2H3.
What are the key properties of 4-(chloromethyl)-2,7-dimethylquinoline?
4-(chloromethyl)-2,7-dimethylquinoline has a molecular weight of 205.69 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,7-dimethylquinoline is sourced from PubChem (CID 23001553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).