C13H12ClN — CID 21495
9-chloro-1,2,3,4-tetrahydroacridine (PubChem CID 21495) has the molecular formula C13H12ClN and a molecular weight of 217.70 g/mol. Its IUPAC name is 9-chloro-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-chloro-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 21495 |
| Molecular Formula | C13H12ClN |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 9-chloro-1,2,3,4-tetrahydroacridine |
| SMILES | Clc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C13H12ClN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2 |
| InChIKey | IYPJWKLHPNECFJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |