About N-ethyl-2,6-dimethylquinolin-4-amine
N-ethyl-2,6-dimethylquinolin-4-amine (PubChem CID 62201642) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N-ethyl-2,6-dimethylquinolin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-2,6-dimethylquinolin-4-amine |
| PubChem CID | 62201642 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-ethyl-2,6-dimethylquinolin-4-amine |
| SMILES | CCNc1cc(C)nc2ccc(C)cc12 |
| InChI | InChI=1S/C13H16N2/c1-4-14-13-8-10(3)15-12-6-5-9(2)7-11(12)13/h5-8H,4H2,1-3H3,(H,14,15) |
| InChIKey | UDVWQSQOZYEPID-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,6-dimethylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,6-dimethylquinolin-4-amine?
The IUPAC name of N-ethyl-2,6-dimethylquinolin-4-amine (CID 62201642) is N-ethyl-2,6-dimethylquinolin-4-amine.
What is the SMILES notation for N-ethyl-2,6-dimethylquinolin-4-amine?
The canonical SMILES for N-ethyl-2,6-dimethylquinolin-4-amine is CCNc1cc(C)nc2ccc(C)cc12.
What is the InChIKey of N-ethyl-2,6-dimethylquinolin-4-amine?
The InChIKey is UDVWQSQOZYEPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-4-14-13-8-10(3)15-12-6-5-9(2)7-11(12)13/h5-8H,4H2,1-3H3,(H,14,15).
What are the key properties of N-ethyl-2,6-dimethylquinolin-4-amine?
N-ethyl-2,6-dimethylquinolin-4-amine has a molecular weight of 200.28 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,6-dimethylquinolin-4-amine is sourced from PubChem (CID 62201642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).