C7H6N4 — CID 155348763
7-methylpyrido[3,4-e][1,2,4]triazine (PubChem CID 155348763) has the molecular formula C7H6N4 and a molecular weight of 146.15 g/mol. Its IUPAC name is 7-methylpyrido[3,4-e][1,2,4]triazine.
| Compound Name | 7-methylpyrido[3,4-e][1,2,4]triazine |
|---|---|
| PubChem CID | 155348763 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 7-methylpyrido[3,4-e][1,2,4]triazine |
| SMILES | Cc1cc2nncnc2cn1 |
| InChI | InChI=1S/C7H6N4/c1-5-2-6-7(3-8-5)9-4-10-11-6/h2-4H,1H3 |
| InChIKey | GNGTTZYDYATNPT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |