C11H18N2O — CID 171095472
ethane;6-methyl-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 171095472) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;6-methyl-[1,3]oxazolo[5,4-c]pyridine.
| Compound Name | ethane;6-methyl-[1,3]oxazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 171095472 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;6-methyl-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | CC.CC.Cc1cc2ncoc2cn1 |
| InChI | InChI=1S/C7H6N2O.2C2H6/c1-5-2-6-7(3-8-5)10-4-9-6;2*1-2/h2-4H,1H3;2*1-2H3 |
| InChIKey | WTUZRYDECWRBKA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |