C20H15N3 — CID 58185780
7,14,18-trimethyl-3,6,10-triazapentacyclo[10.7.1.02,11.04,9.016,20]icosa-1(19),2,4(9),5,7,10,12,14,16(20),17-decaene (PubChem CID 58185780) has the molecular formula C20H15N3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 7,14,18-trimethyl-3,6,10-triazapentacyclo[10.7.1.02,11.04,9.016,20]icosa-1(19),2,4(9),5,7,10,12,14,16(20),17-decaene.
| Compound Name | 7,14,18-trimethyl-3,6,10-triazapentacyclo[10.7.1.02,11.04,9.016,20]icosa-1(19),2,4(9),5,7,10,12,14,16(20),17-decaene |
|---|---|
| PubChem CID | 58185780 |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 7,14,18-trimethyl-3,6,10-triazapentacyclo[10.7.1.02,11.04,9.016,20]icosa-1(19),2,4(9),5,7,10,12,14,16(20),17-decaene |
| SMILES | Cc1cc2c3c(cc(C)cc3c1)-c1nc3cc(C)ncc3nc1-2 |
| InChI | InChI=1S/C20H15N3/c1-10-4-13-5-11(2)7-15-18(13)14(6-10)19-20(15)23-17-9-21-12(3)8-16(17)22-19/h4-9H,1-3H3 |
| InChIKey | AYGXLNNQLYPIKZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |