About 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine
2,3-dimethylpyrido[3,4-b]pyrazin-7-amine (PubChem CID 162530098) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine.
Molecular Properties
| Compound Name | 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine |
| PubChem CID | 162530098 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine |
| SMILES | Cc1nc2cnc(N)cc2nc1C |
| InChI | InChI=1S/C9H10N4/c1-5-6(2)13-8-4-11-9(10)3-7(8)12-5/h3-4H,1-2H3,(H2,10,11) |
| InChIKey | MPCYLONMXSYTGP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine?
The IUPAC name of 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine (CID 162530098) is 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine.
What is the SMILES notation for 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine?
The canonical SMILES for 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine is Cc1nc2cnc(N)cc2nc1C.
What is the InChIKey of 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine?
The InChIKey is MPCYLONMXSYTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-5-6(2)13-8-4-11-9(10)3-7(8)12-5/h3-4H,1-2H3,(H2,10,11).
What are the key properties of 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine?
2,3-dimethylpyrido[3,4-b]pyrazin-7-amine has a molecular weight of 174.21 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpyrido[3,4-b]pyrazin-7-amine is sourced from PubChem (CID 162530098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).