C5H7N3O — CID 133056691
4,6-diaminopyridin-3-ol (PubChem CID 133056691) has the molecular formula C5H7N3O and a molecular weight of 125.13 g/mol. Its IUPAC name is 4,6-diaminopyridin-3-ol.
| Compound Name | 4,6-diaminopyridin-3-ol |
|---|---|
| PubChem CID | 133056691 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 4,6-diaminopyridin-3-ol |
| SMILES | Nc1cc(N)c(O)cn1 |
| InChI | InChI=1S/C5H7N3O/c6-3-1-5(7)8-2-4(3)9/h1-2,9H,(H4,6,7,8) |
| InChIKey | SJMXSXRTOIGRLL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |