C5H7ClN4 — CID 87287870
5-N-chloropyridine-2,4,5-triamine (PubChem CID 87287870) has the molecular formula C5H7ClN4 and a molecular weight of 158.59 g/mol. Its IUPAC name is 5-N-chloropyridine-2,4,5-triamine.
| Compound Name | 5-N-chloropyridine-2,4,5-triamine |
|---|---|
| PubChem CID | 87287870 |
| Molecular Formula | C5H7ClN4 |
| Molecular Weight | 158.59 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 5-N-chloropyridine-2,4,5-triamine |
| SMILES | Nc1cc(N)c(NCl)cn1 |
| InChI | InChI=1S/C5H7ClN4/c6-10-4-2-9-5(8)1-3(4)7/h1-2,10H,(H4,7,8,9) |
| InChIKey | JIFVLLDJKILMRS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.59 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|