C10H9Cl2N5 — CID 89380661
4-N-(2-amino-4,5-dichlorophenyl)pyrimidine-4,6-diamine (PubChem CID 89380661) has the molecular formula C10H9Cl2N5 and a molecular weight of 270.12 g/mol. Its IUPAC name is 4-N-(2-amino-4,5-dichlorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-amino-4,5-dichlorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 89380661 |
| Molecular Formula | C10H9Cl2N5 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 4-N-(2-amino-4,5-dichlorophenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1cc(Nc2cc(Cl)c(Cl)cc2N)ncn1 |
| InChI | InChI=1S/C10H9Cl2N5/c11-5-1-7(13)8(2-6(5)12)17-10-3-9(14)15-4-16-10/h1-4H,13H2,(H3,14,15,16,17) |
| InChIKey | WIAFKDGLZFFRQM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|