C10H10N4 — CID 3031502
4-N-phenylpyrimidine-4,6-diamine (PubChem CID 3031502) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 3031502 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 4-N-phenylpyrimidine-4,6-diamine |
| SMILES | Nc1cc(Nc2ccccc2)ncn1 |
| InChI | InChI=1S/C10H10N4/c11-9-6-10(13-7-12-9)14-8-4-2-1-3-5-8/h1-7H,(H3,11,12,13,14) |
| InChIKey | QHMLYBPYRIVJDA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |