C13H17N5 — CID 66670014
4-N-[3-[(dimethylamino)methyl]phenyl]pyrimidine-4,6-diamine (PubChem CID 66670014) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-N-[3-[(dimethylamino)methyl]phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[3-[(dimethylamino)methyl]phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 66670014 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 4-N-[3-[(dimethylamino)methyl]phenyl]pyrimidine-4,6-diamine |
| SMILES | CN(C)Cc1cccc(Nc2cc(N)ncn2)c1 |
| InChI | InChI=1S/C13H17N5/c1-18(2)8-10-4-3-5-11(6-10)17-13-7-12(14)15-9-16-13/h3-7,9H,8H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | IYSTUMSUFZKMGY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |