C12H15N5 — CID 66669910
4-N-[3-(dimethylamino)phenyl]pyrimidine-4,6-diamine (PubChem CID 66669910) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[3-(dimethylamino)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 66669910 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 4-N-[3-(dimethylamino)phenyl]pyrimidine-4,6-diamine |
| SMILES | CN(C)c1cccc(Nc2cc(N)ncn2)c1 |
| InChI | InChI=1S/C12H15N5/c1-17(2)10-5-3-4-9(6-10)16-12-7-11(13)14-8-15-12/h3-8H,1-2H3,(H3,13,14,15,16) |
| InChIKey | HZIXPXZBBHKBEX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |