C8H8N4 — CID 141099373
2,6-naphthyridine-3,7-diamine (PubChem CID 141099373) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 2,6-naphthyridine-3,7-diamine.
| Compound Name | 2,6-naphthyridine-3,7-diamine |
|---|---|
| PubChem CID | 141099373 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2,6-naphthyridine-3,7-diamine |
| SMILES | Nc1cc2cnc(N)cc2cn1 |
| InChI | InChI=1S/C8H8N4/c9-7-1-5-3-12-8(10)2-6(5)4-11-7/h1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | FASNAFRMRNPTAY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |