C8H6ClN3 — CID 138605042
2-chloro-1,6-naphthyridin-7-amine (PubChem CID 138605042) has the molecular formula C8H6ClN3 and a molecular weight of 179.61 g/mol. Its IUPAC name is 2-chloro-1,6-naphthyridin-7-amine.
| Compound Name | 2-chloro-1,6-naphthyridin-7-amine |
|---|---|
| PubChem CID | 138605042 |
| Molecular Formula | C8H6ClN3 |
| Molecular Weight | 179.61 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2-chloro-1,6-naphthyridin-7-amine |
| SMILES | Nc1cc2nc(Cl)ccc2cn1 |
| InChI | InChI=1S/C8H6ClN3/c9-7-2-1-5-4-11-8(10)3-6(5)12-7/h1-4H,(H2,10,11) |
| InChIKey | OQCPFKPBNKWVPU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.61 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|