About 2-chloroquinolin-7-ol
2-chloroquinolin-7-ol (PubChem CID 135427710) has the molecular formula C9H6ClNO
and a molecular weight of 179.61 g/mol. Its IUPAC name is 2-chloroquinolin-7-ol.
Molecular Properties
| Compound Name | 2-chloroquinolin-7-ol |
| PubChem CID | 135427710 |
| Molecular Formula | C9H6ClNO |
| Molecular Weight | 179.61 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | 2-chloroquinolin-7-ol |
| SMILES | Oc1ccc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C9H6ClNO/c10-9-4-2-6-1-3-7(12)5-8(6)11-9/h1-5,12H |
| InChIKey | OKRDYODLCPEIMP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.61 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroquinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroquinolin-7-ol?
The IUPAC name of 2-chloroquinolin-7-ol (CID 135427710) is 2-chloroquinolin-7-ol.
What is the SMILES notation for 2-chloroquinolin-7-ol?
The canonical SMILES for 2-chloroquinolin-7-ol is Oc1ccc2ccc(Cl)nc2c1.
What is the InChIKey of 2-chloroquinolin-7-ol?
The InChIKey is OKRDYODLCPEIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO/c10-9-4-2-6-1-3-7(12)5-8(6)11-9/h1-5,12H.
What are the key properties of 2-chloroquinolin-7-ol?
2-chloroquinolin-7-ol has a molecular weight of 179.61 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroquinolin-7-ol is sourced from PubChem (CID 135427710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).