About 2,6-dichloro-1,7-naphthyridine
2,6-dichloro-1,7-naphthyridine (PubChem CID 15592374) has the molecular formula C8H4Cl2N2
and a molecular weight of 199.04 g/mol. Its IUPAC name is 2,6-dichloro-1,7-naphthyridine.
Molecular Properties
| Compound Name | 2,6-dichloro-1,7-naphthyridine |
| PubChem CID | 15592374 |
| Molecular Formula | C8H4Cl2N2 |
| Molecular Weight | 199.04 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 2,6-dichloro-1,7-naphthyridine |
| SMILES | Clc1cc2ccc(Cl)nc2cn1 |
| InChI | InChI=1S/C8H4Cl2N2/c9-7-2-1-5-3-8(10)11-4-6(5)12-7/h1-4H |
| InChIKey | UTSKFSYPNOCOSH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.04 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-1,7-naphthyridine?
The IUPAC name of 2,6-dichloro-1,7-naphthyridine (CID 15592374) is 2,6-dichloro-1,7-naphthyridine.
What is the SMILES notation for 2,6-dichloro-1,7-naphthyridine?
The canonical SMILES for 2,6-dichloro-1,7-naphthyridine is Clc1cc2ccc(Cl)nc2cn1.
What is the InChIKey of 2,6-dichloro-1,7-naphthyridine?
The InChIKey is UTSKFSYPNOCOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2/c9-7-2-1-5-3-8(10)11-4-6(5)12-7/h1-4H.
What are the key properties of 2,6-dichloro-1,7-naphthyridine?
2,6-dichloro-1,7-naphthyridine has a molecular weight of 199.04 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-1,7-naphthyridine is sourced from PubChem (CID 15592374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).