About 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine
5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine (PubChem CID 174640637) has the molecular formula C10H14F3N3
and a molecular weight of 233.24 g/mol. Its IUPAC name is 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine |
| PubChem CID | 174640637 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine |
| SMILES | CC(C)(C)Nc1cnc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3/c1-9(2,3)16-7-5-15-8(14)4-6(7)10(11,12)13/h4-5,16H,1-3H3,(H2,14,15) |
| InChIKey | ZWIZFZUPSOONAX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine?
The IUPAC name of 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine (CID 174640637) is 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine.
What is the SMILES notation for 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine?
The canonical SMILES for 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine is CC(C)(C)Nc1cnc(N)cc1C(F)(F)F.
What is the InChIKey of 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine?
The InChIKey is ZWIZFZUPSOONAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3/c1-9(2,3)16-7-5-15-8(14)4-6(7)10(11,12)13/h4-5,16H,1-3H3,(H2,14,15).
What are the key properties of 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine?
5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine has a molecular weight of 233.24 g/mol, XLogP of 2.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-tert-butyl-4-(trifluoromethyl)pyridine-2,5-diamine is sourced from PubChem (CID 174640637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).