C10H12N4 — CID 11513893
2,3-dimethylquinoxaline-6,7-diamine (PubChem CID 11513893) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2,3-dimethylquinoxaline-6,7-diamine.
| Compound Name | 2,3-dimethylquinoxaline-6,7-diamine |
|---|---|
| PubChem CID | 11513893 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2,3-dimethylquinoxaline-6,7-diamine |
| SMILES | Cc1nc2cc(N)c(N)cc2nc1C |
| InChI | InChI=1S/C10H12N4/c1-5-6(2)14-10-4-8(12)7(11)3-9(10)13-5/h3-4H,11-12H2,1-2H3 |
| InChIKey | LUVHNWIGUSDTAU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|