C6H10N4 — CID 55281971
6-methylpyridine-2,3,4-triamine (PubChem CID 55281971) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 6-methylpyridine-2,3,4-triamine.
| Compound Name | 6-methylpyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 55281971 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 6-methylpyridine-2,3,4-triamine |
| SMILES | Cc1cc(N)c(N)c(N)n1 |
| InChI | InChI=1S/C6H10N4/c1-3-2-4(7)5(8)6(9)10-3/h2H,8H2,1H3,(H4,7,9,10) |
| InChIKey | ZDDXYQCYGIUERO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |