C6H10ClN3 — CID 140629054
4,6-dimethylpyrimidin-2-amine;hydrochloride (PubChem CID 140629054) has the molecular formula C6H10ClN3 and a molecular weight of 159.62 g/mol. Its IUPAC name is 4,6-dimethylpyrimidin-2-amine;hydrochloride.
| Compound Name | 4,6-dimethylpyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 140629054 |
| Molecular Formula | C6H10ClN3 |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 4,6-dimethylpyrimidin-2-amine;hydrochloride |
| SMILES | Cc1cc(C)nc(N)n1.Cl |
| InChI | InChI=1S/C6H9N3.ClH/c1-4-3-5(2)9-6(7)8-4;/h3H,1-2H3,(H2,7,8,9);1H |
| InChIKey | ZVPNVVRFMZWANH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |