C6H11ClN4 — CID 134128947
(4,6-dimethylpyrimidin-2-yl)hydrazine;hydrochloride (PubChem CID 134128947) has the molecular formula C6H11ClN4 and a molecular weight of 174.64 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-2-yl)hydrazine;hydrochloride.
| Compound Name | (4,6-dimethylpyrimidin-2-yl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 134128947 |
| Molecular Formula | C6H11ClN4 |
| Molecular Weight | 174.64 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (4,6-dimethylpyrimidin-2-yl)hydrazine;hydrochloride |
| SMILES | Cc1cc(C)nc(NN)n1.Cl |
| InChI | InChI=1S/C6H10N4.ClH/c1-4-3-5(2)9-6(8-4)10-7;/h3H,7H2,1-2H3,(H,8,9,10);1H |
| InChIKey | ZRCMRVOAHKRZMI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.64 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|