C11H10Cl2N4S — CID 80929995
[4-(3,4-dichlorophenyl)sulfanyl-6-methylpyrimidin-2-yl]hydrazine (PubChem CID 80929995) has the molecular formula C11H10Cl2N4S and a molecular weight of 301.20 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)sulfanyl-6-methylpyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3,4-dichlorophenyl)sulfanyl-6-methylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80929995 |
| Molecular Formula | C11H10Cl2N4S |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | [4-(3,4-dichlorophenyl)sulfanyl-6-methylpyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc(Sc2ccc(Cl)c(Cl)c2)nc(NN)n1 |
| InChI | InChI=1S/C11H10Cl2N4S/c1-6-4-10(16-11(15-6)17-14)18-7-2-3-8(12)9(13)5-7/h2-5H,14H2,1H3,(H,15,16,17) |
| InChIKey | PYSSAFZADOGXRA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|