C10H12N6S — CID 80923071
[4-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-yl]hydrazine (PubChem CID 80923071) has the molecular formula C10H12N6S and a molecular weight of 248.31 g/mol. Its IUPAC name is [4-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-yl]hydrazine.
| Compound Name | [4-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80923071 |
| Molecular Formula | C10H12N6S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | [4-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-2-yl]hydrazine |
| SMILES | Cc1cnc(Sc2cc(C)nc(NN)n2)nc1 |
| InChI | InChI=1S/C10H12N6S/c1-6-4-12-10(13-5-6)17-8-3-7(2)14-9(15-8)16-11/h3-5H,11H2,1-2H3,(H,14,15,16) |
| InChIKey | WIRPZHXSEQNAPC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|