C10H11N5S — CID 80892120
2-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-4-amine (PubChem CID 80892120) has the molecular formula C10H11N5S and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-4-amine.
| Compound Name | 2-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80892120 |
| Molecular Formula | C10H11N5S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-methyl-6-(5-methylpyrimidin-2-yl)sulfanylpyrimidin-4-amine |
| SMILES | Cc1cnc(Sc2cc(N)nc(C)n2)nc1 |
| InChI | InChI=1S/C10H11N5S/c1-6-4-12-10(13-5-6)16-9-3-8(11)14-7(2)15-9/h3-5H,1-2H3,(H2,11,14,15) |
| InChIKey | XVGFDTQNWSXLCQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |