C11H9F2N3S — CID 115507622
2,4-difluoro-6-(5-methylpyrimidin-2-yl)sulfanylaniline (PubChem CID 115507622) has the molecular formula C11H9F2N3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2,4-difluoro-6-(5-methylpyrimidin-2-yl)sulfanylaniline.
| Compound Name | 2,4-difluoro-6-(5-methylpyrimidin-2-yl)sulfanylaniline |
|---|---|
| PubChem CID | 115507622 |
| Molecular Formula | C11H9F2N3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2,4-difluoro-6-(5-methylpyrimidin-2-yl)sulfanylaniline |
| SMILES | Cc1cnc(Sc2cc(F)cc(F)c2N)nc1 |
| InChI | InChI=1S/C11H9F2N3S/c1-6-4-15-11(16-5-6)17-9-3-7(12)2-8(13)10(9)14/h2-5H,14H2,1H3 |
| InChIKey | BVDZGBZFGGJDDU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|