C12H12N6S2 — CID 103336591
[6-methyl-4-(5-methylpyrimidin-2-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336591) has the molecular formula C12H12N6S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is [6-methyl-4-(5-methylpyrimidin-2-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [6-methyl-4-(5-methylpyrimidin-2-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336591 |
| Molecular Formula | C12H12N6S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [6-methyl-4-(5-methylpyrimidin-2-yl)sulfanylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cnc(Sc2nc(NN)nc3sc(C)cc23)nc1 |
| InChI | InChI=1S/C12H12N6S2/c1-6-4-14-12(15-5-6)20-10-8-3-7(2)19-9(8)16-11(17-10)18-13/h3-5H,13H2,1-2H3,(H,16,17,18) |
| InChIKey | OQKURDMPEGICHD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|