C13H10F2N4S2 — CID 103336488
[4-(2,4-difluorophenyl)sulfanyl-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103336488) has the molecular formula C13H10F2N4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)sulfanyl-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,4-difluorophenyl)sulfanyl-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103336488 |
| Molecular Formula | C13H10F2N4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | [4-(2,4-difluorophenyl)sulfanyl-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc2c(Sc3ccc(F)cc3F)nc(NN)nc2s1 |
| InChI | InChI=1S/C13H10F2N4S2/c1-6-4-8-11(20-6)17-13(19-16)18-12(8)21-10-3-2-7(14)5-9(10)15/h2-5H,16H2,1H3,(H,17,18,19) |
| InChIKey | OCROYWXWNGKGGA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|