C14H16F2N4S — CID 81000644
[6-(2,4-difluorophenyl)sulfanyl-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 81000644) has the molecular formula C14H16F2N4S and a molecular weight of 310.37 g/mol. Its IUPAC name is [6-(2,4-difluorophenyl)sulfanyl-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,4-difluorophenyl)sulfanyl-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 81000644 |
| Molecular Formula | C14H16F2N4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [6-(2,4-difluorophenyl)sulfanyl-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1c(NN)nc(C(C)C)nc1Sc1ccc(F)cc1F |
| InChI | InChI=1S/C14H16F2N4S/c1-7(2)12-18-13(20-17)8(3)14(19-12)21-11-5-4-9(15)6-10(11)16/h4-7H,17H2,1-3H3,(H,18,19,20) |
| InChIKey | OXBVKWNWAWQPNE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|