C12H17N5OS — CID 106928843
[5-methyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 106928843) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is [5-methyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [5-methyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106928843 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | [5-methyl-6-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1coc(Sc2nc(C(C)C)nc(NN)c2C)n1 |
| InChI | InChI=1S/C12H17N5OS/c1-6(2)9-15-10(17-13)8(4)11(16-9)19-12-14-7(3)5-18-12/h5-6H,13H2,1-4H3,(H,15,16,17) |
| InChIKey | HUOQLPDAKIGUOV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|